About 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate
2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate (PubChem CID 18935720) has the molecular formula C23H26NO3-
and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate |
| PubChem CID | 18935720 |
| Molecular Formula | C23H26NO3- |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)[O-].CCCCCCOc1ccccc1-c1ccccc1C#N |
| InChI | InChI=1S/C19H21NO.C4H6O2/c1-2-3-4-9-14-21-19-13-8-7-12-18(19)17-11-6-5-10-16(17)15-20;1-3(2)4(5)6/h5-8,10-13H,2-4,9,14H2,1H3;1H2,2H3,(H,5,6)/p-1 |
| InChIKey | MQCGJFKMUHZZSV-UHFFFAOYSA-M |
| XLogP | 4.50 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate?
The IUPAC name of 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate (CID 18935720) is 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate.
What is the SMILES notation for 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate?
The canonical SMILES for 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate is C=C(C)C(=O)[O-].CCCCCCOc1ccccc1-c1ccccc1C#N.
What is the InChIKey of 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate?
The InChIKey is MQCGJFKMUHZZSV-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H21NO.C4H6O2/c1-2-3-4-9-14-21-19-13-8-7-12-18(19)17-11-6-5-10-16(17)15-20;1-3(2)4(5)6/h5-8,10-13H,2-4,9,14H2,1H3;1H2,2H3,(H,5,6)/p-1.
What are the key properties of 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate?
2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate has a molecular weight of 364.47 g/mol, XLogP of 4.50, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hexoxyphenyl)benzonitrile;2-methylprop-2-enoate is sourced from PubChem (CID 18935720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).