C8H13N2O6PS — CID 18936084
2-[methyl(pyridin-2-yl)amino]-1-phosphonoethanesulfonic acid (PubChem CID 18936084) has the molecular formula C8H13N2O6PS and a molecular weight of 296.24 g/mol. Its IUPAC name is 2-[methyl(pyridin-2-yl)amino]-1-phosphonoethanesulfonic acid.
| Compound Name | 2-[methyl(pyridin-2-yl)amino]-1-phosphonoethanesulfonic acid |
|---|---|
| PubChem CID | 18936084 |
| Molecular Formula | C8H13N2O6PS |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-[methyl(pyridin-2-yl)amino]-1-phosphonoethanesulfonic acid |
| SMILES | CN(CC(P(=O)(O)O)S(=O)(=O)O)c1ccccn1 |
| InChI | InChI=1S/C8H13N2O6PS/c1-10(7-4-2-3-5-9-7)6-8(17(11,12)13)18(14,15)16/h2-5,8H,6H2,1H3,(H2,11,12,13)(H,14,15,16) |
| InChIKey | DNRQQOALZSNDHK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|