About 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene
2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 18940346) has the molecular formula C9H8F6
and a molecular weight of 230.15 g/mol. Its IUPAC name is 2-methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene.
Analyze 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene (CID 18940346) is 2-methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene is CC1=C(CCC=C1C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is YHVMNSFAINWVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6/c1-5-6(8(10,11)12)3-2-4-7(5)9(13,14)15/h3H,2,4H2,1H3.
What are the key properties of 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene?
2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 230.15 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Methyl-1,3-bis(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 18940346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).