C23H22BrN3O3 — CID 18940878
5-methoxy-3-[[1-[2-(4-nitrophenyl)ethyl]pyridin-1-ium-3-yl]methyl]-1H-indole bromide (PubChem CID 18940878) has the molecular formula C23H22BrN3O3 and a molecular weight of 468.35 g/mol. Its IUPAC name is 5-methoxy-3-[[1-[2-(4-nitrophenyl)ethyl]pyridin-1-ium-3-yl]methyl]-1H-indole bromide.
| Compound Name | 5-methoxy-3-[[1-[2-(4-nitrophenyl)ethyl]pyridin-1-ium-3-yl]methyl]-1H-indole bromide |
|---|---|
| PubChem CID | 18940878 |
| Molecular Formula | C23H22BrN3O3 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 5-methoxy-3-[[1-[2-(4-nitrophenyl)ethyl]pyridin-1-ium-3-yl]methyl]-1H-indole bromide |
| SMILES | COc1ccc2[nH]cc(Cc3ccc[n+](CCc4ccc([N+](=O)[O-])cc4)c3)c2c1.[Br-] |
| InChI | InChI=1S/C23H22N3O3.BrH/c1-29-21-8-9-23-22(14-21)19(15-24-23)13-18-3-2-11-25(16-18)12-10-17-4-6-20(7-5-17)26(27)28;/h2-9,11,14-16,24H,10,12-13H2,1H3;1H/q+1;/p-1 |
| InChIKey | KJADETVQQLWRIX-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|