C13H22N2O2 — CID 18940925
1-(2,2-dimethoxyethyl)-2-(4-propylphenyl)hydrazine (PubChem CID 18940925) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-(4-propylphenyl)hydrazine.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-(4-propylphenyl)hydrazine |
|---|---|
| PubChem CID | 18940925 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-(4-propylphenyl)hydrazine |
| SMILES | CCCc1ccc(NNCC(OC)OC)cc1 |
| InChI | InChI=1S/C13H22N2O2/c1-4-5-11-6-8-12(9-7-11)15-14-10-13(16-2)17-3/h6-9,13-15H,4-5,10H2,1-3H3 |
| InChIKey | KADWRYUWENGSGH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|