C17H18N2OS — CID 18940973
2-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-piperidin-1-ylethanone (PubChem CID 18940973) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-piperidin-1-ylethanone.
| Compound Name | 2-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 18940973 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-piperidin-1-ylethanone |
| SMILES | O=C(Cc1nc2c(s1)Cc1ccccc1-2)N1CCCCC1 |
| InChI | InChI=1S/C17H18N2OS/c20-16(19-8-4-1-5-9-19)11-15-18-17-13-7-3-2-6-12(13)10-14(17)21-15/h2-3,6-7H,1,4-5,8-11H2 |
| InChIKey | VIEQJCDFERZKDU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |