About dimethoxy(dimethyl)silane;tetramethyl silicate
dimethoxy(dimethyl)silane;tetramethyl silicate (PubChem CID 18941680) has the molecular formula C8H24O6Si2
and a molecular weight of 272.45 g/mol. Its IUPAC name is dimethoxy(dimethyl)silane;tetramethyl silicate.
Molecular Properties
| Compound Name | dimethoxy(dimethyl)silane;tetramethyl silicate |
| PubChem CID | 18941680 |
| Molecular Formula | C8H24O6Si2 |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | dimethoxy(dimethyl)silane;tetramethyl silicate |
| SMILES | CO[Si](C)(C)OC.CO[Si](OC)(OC)OC |
| InChI | InChI=1S/C4H12O4Si.C4H12O2Si/c1-5-9(6-2,7-3)8-4;1-5-7(3,4)6-2/h1-4H3;1-4H3 |
| InChIKey | JMWSTNKTICBRGI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(dimethyl)silane;tetramethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(dimethyl)silane;tetramethyl silicate?
The IUPAC name of dimethoxy(dimethyl)silane;tetramethyl silicate (CID 18941680) is dimethoxy(dimethyl)silane;tetramethyl silicate.
What is the SMILES notation for dimethoxy(dimethyl)silane;tetramethyl silicate?
The canonical SMILES for dimethoxy(dimethyl)silane;tetramethyl silicate is CO[Si](C)(C)OC.CO[Si](OC)(OC)OC.
What is the InChIKey of dimethoxy(dimethyl)silane;tetramethyl silicate?
The InChIKey is JMWSTNKTICBRGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O4Si.C4H12O2Si/c1-5-9(6-2,7-3)8-4;1-5-7(3,4)6-2/h1-4H3;1-4H3.
What are the key properties of dimethoxy(dimethyl)silane;tetramethyl silicate?
dimethoxy(dimethyl)silane;tetramethyl silicate has a molecular weight of 272.45 g/mol, XLogP of 0.99, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(dimethyl)silane;tetramethyl silicate is sourced from PubChem (CID 18941680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).