C36H43FO9S2 — CID 18945711
4-fluorobenzenesulfonate;tris[4-(1-ethoxyethoxy)phenyl]sulfanium (PubChem CID 18945711) has the molecular formula C36H43FO9S2 and a molecular weight of 702.86 g/mol. Its IUPAC name is 4-fluorobenzenesulfonate;tris[4-(1-ethoxyethoxy)phenyl]sulfanium.
| Compound Name | 4-fluorobenzenesulfonate;tris[4-(1-ethoxyethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 18945711 |
| Molecular Formula | C36H43FO9S2 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.23 |
| IUPAC Name | 4-fluorobenzenesulfonate;tris[4-(1-ethoxyethoxy)phenyl]sulfanium |
| SMILES | CCOC(C)Oc1ccc([S+](c2ccc(OC(C)OCC)cc2)c2ccc(OC(C)OCC)cc2)cc1.O=S(=O)([O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C30H39O6S.C6H5FO3S/c1-7-31-22(4)34-25-10-16-28(17-11-25)37(29-18-12-26(13-19-29)35-23(5)32-8-2)30-20-14-27(15-21-30)36-24(6)33-9-3;7-5-1-3-6(4-2-5)11(8,9)10/h10-24H,7-9H2,1-6H3;1-4H,(H,8,9,10)/q+1;/p-1 |
| InChIKey | QYRQIUTVGCGJOR-UHFFFAOYSA-M |
| XLogP | 7.80 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|