C29H32F6O6S2 — CID 160599604
bis(4-butoxyphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate (PubChem CID 160599604) has the molecular formula C29H32F6O6S2 and a molecular weight of 654.69 g/mol. Its IUPAC name is bis(4-butoxyphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate.
| Compound Name | bis(4-butoxyphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 160599604 |
| Molecular Formula | C29H32F6O6S2 |
| Molecular Weight | 654.69 g/mol |
| Exact Mass | 654.15 |
| IUPAC Name | bis(4-butoxyphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate |
| SMILES | CCCCOc1ccc([S+](c2ccc(F)cc2)c2ccc(OCCCC)cc2)cc1.O=S(=O)([O-])C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C26H30FO2S.C3H3F5O4S/c1-3-5-19-28-22-9-15-25(16-10-22)30(24-13-7-21(27)8-14-24)26-17-11-23(12-18-26)29-20-6-4-2;4-2(5,6)1(9)3(7,8)13(10,11)12/h7-18H,3-6,19-20H2,1-2H3;1,9H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | RECCUVQGQXPXAK-UHFFFAOYSA-M |
| XLogP | 7.33 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|