C25H26F2N2O3 — CID 18945861
4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoic acid (PubChem CID 18945861) has the molecular formula C25H26F2N2O3 and a molecular weight of 440.49 g/mol. Its IUPAC name is 4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoic acid.
| Compound Name | 4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 18945861 |
| Molecular Formula | C25H26F2N2O3 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoic acid |
| SMILES | CCCCCCC(F)COc1ccc(-c2ncc(-c3ccc(C(=O)O)cc3)cn2)cc1F |
| InChI | InChI=1S/C25H26F2N2O3/c1-2-3-4-5-6-21(26)16-32-23-12-11-19(13-22(23)27)24-28-14-20(15-29-24)17-7-9-18(10-8-17)25(30)31/h7-15,21H,2-6,16H2,1H3,(H,30,31) |
| InChIKey | KIPVNTCKPVTXIH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|