C23H29N5O — CID 18946515
5-[4-[1-(4-cyanobutyl)benzimidazole-2-carbonyl]piperidin-1-yl]pentanenitrile (PubChem CID 18946515) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is 5-[4-[1-(4-cyanobutyl)benzimidazole-2-carbonyl]piperidin-1-yl]pentanenitrile.
| Compound Name | 5-[4-[1-(4-cyanobutyl)benzimidazole-2-carbonyl]piperidin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 18946515 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 5-[4-[1-(4-cyanobutyl)benzimidazole-2-carbonyl]piperidin-1-yl]pentanenitrile |
| SMILES | N#CCCCCN1CCC(C(=O)c2nc3ccccc3n2CCCCC#N)CC1 |
| InChI | InChI=1S/C23H29N5O/c24-13-5-1-7-15-27-17-11-19(12-18-27)22(29)23-26-20-9-3-4-10-21(20)28(23)16-8-2-6-14-25/h3-4,9-10,19H,1-2,5-8,11-12,15-18H2 |
| InChIKey | GZLPAMIHERNMAK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 85.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|