C23H30N4O4 — CID 18946516
methyl 2-[2-[1-(4-cyanobutyl)piperidine-4-carbonyl]benzimidazol-1-yl]-2-methoxypropanoate (PubChem CID 18946516) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is methyl 2-[2-[1-(4-cyanobutyl)piperidine-4-carbonyl]benzimidazol-1-yl]-2-methoxypropanoate.
| Compound Name | methyl 2-[2-[1-(4-cyanobutyl)piperidine-4-carbonyl]benzimidazol-1-yl]-2-methoxypropanoate |
|---|---|
| PubChem CID | 18946516 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | methyl 2-[2-[1-(4-cyanobutyl)piperidine-4-carbonyl]benzimidazol-1-yl]-2-methoxypropanoate |
| SMILES | COC(=O)C(C)(OC)n1c(C(=O)C2CCN(CCCCC#N)CC2)nc2ccccc21 |
| InChI | InChI=1S/C23H30N4O4/c1-23(31-3,22(29)30-2)27-19-10-6-5-9-18(19)25-21(27)20(28)17-11-15-26(16-12-17)14-8-4-7-13-24/h5-6,9-10,17H,4,7-8,11-12,14-16H2,1-3H3 |
| InChIKey | VBQVGEAUQHFHOV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|