2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate

C10H9ClN2O5 — CID 18949896

IUPAC2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate
SMILESO=C1c2ccc(Cl)cc2C(O)N1CCO[N+](=O)[O-]
InChIInChI=1S/C10H9ClN2O5/c11-6-1-2-7-8(5-6)10(15)12(9(7)14)3-4-18-13(16)17/h1-2,5,10,15H,3-4H2
InChIKeyMQUHKGWOYXPGKB-UHFFFAOYSA-N
MW272.64 g/mol
LogP1.00
Rot. Bonds4

About 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate

2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate (PubChem CID 18949896) has the molecular formula C10H9ClN2O5 and a molecular weight of 272.64 g/mol. Its IUPAC name is 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate.

Molecular Properties

Compound Name2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate
PubChem CID18949896
Molecular FormulaC10H9ClN2O5
Molecular Weight272.64 g/mol
Exact Mass272.02
IUPAC Name2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate
SMILESO=C1c2ccc(Cl)cc2C(O)N1CCO[N+](=O)[O-]
InChIInChI=1S/C10H9ClN2O5/c11-6-1-2-7-8(5-6)10(15)12(9(7)14)3-4-18-13(16)17/h1-2,5,10,15H,3-4H2
InChIKeyMQUHKGWOYXPGKB-UHFFFAOYSA-N
XLogP1.00
TPSA92.91 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.64
LogP ≤ 51.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate?
The IUPAC name of 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate (CID 18949896) is 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate.
What is the SMILES notation for 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate?
The canonical SMILES for 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate is O=C1c2ccc(Cl)cc2C(O)N1CCO[N+](=O)[O-].
What is the InChIKey of 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate?
The InChIKey is MQUHKGWOYXPGKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O5/c11-6-1-2-7-8(5-6)10(15)12(9(7)14)3-4-18-13(16)17/h1-2,5,10,15H,3-4H2.
What are the key properties of 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate?
2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate has a molecular weight of 272.64 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-1-hydroxy-3-oxo-1H-isoindol-2-yl)ethyl nitrate is sourced from PubChem (CID 18949896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).