About hexyl 3-sulfooxybutanoate
hexyl 3-sulfooxybutanoate (PubChem CID 18955074) has the molecular formula C10H20O6S
and a molecular weight of 268.33 g/mol. Its IUPAC name is hexyl 3-sulfooxybutanoate.
Molecular Properties
| Compound Name | hexyl 3-sulfooxybutanoate |
| PubChem CID | 18955074 |
| Molecular Formula | C10H20O6S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | hexyl 3-sulfooxybutanoate |
| SMILES | CCCCCCOC(=O)CC(C)OS(=O)(=O)O |
| InChI | InChI=1S/C10H20O6S/c1-3-4-5-6-7-15-10(11)8-9(2)16-17(12,13)14/h9H,3-8H2,1-2H3,(H,12,13,14) |
| InChIKey | HDFWETBUMAXHJF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hexyl 3-sulfooxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 3-sulfooxybutanoate?
The IUPAC name of hexyl 3-sulfooxybutanoate (CID 18955074) is hexyl 3-sulfooxybutanoate.
What is the SMILES notation for hexyl 3-sulfooxybutanoate?
The canonical SMILES for hexyl 3-sulfooxybutanoate is CCCCCCOC(=O)CC(C)OS(=O)(=O)O.
What is the InChIKey of hexyl 3-sulfooxybutanoate?
The InChIKey is HDFWETBUMAXHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O6S/c1-3-4-5-6-7-15-10(11)8-9(2)16-17(12,13)14/h9H,3-8H2,1-2H3,(H,12,13,14).
What are the key properties of hexyl 3-sulfooxybutanoate?
hexyl 3-sulfooxybutanoate has a molecular weight of 268.33 g/mol, XLogP of 1.71, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 3-sulfooxybutanoate is sourced from PubChem (CID 18955074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).