C14H13F4NO2 — CID 18955394
2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2,2-difluoro-N-(1-methylcyclopropyl)acetamide (PubChem CID 18955394) has the molecular formula C14H13F4NO2 and a molecular weight of 303.25 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2,2-difluoro-N-(1-methylcyclopropyl)acetamide.
| Compound Name | 2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2,2-difluoro-N-(1-methylcyclopropyl)acetamide |
|---|---|
| PubChem CID | 18955394 |
| Molecular Formula | C14H13F4NO2 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2,2-difluoro-N-(1-methylcyclopropyl)acetamide |
| SMILES | CC1(NC(=O)C(F)(F)C2(c3ccc(F)cc3F)CO2)CC1 |
| InChI | InChI=1S/C14H13F4NO2/c1-12(4-5-12)19-11(20)14(17,18)13(7-21-13)9-3-2-8(15)6-10(9)16/h2-3,6H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | TYUIUDYJNKGRPT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|