C10H8F3NO2 — CID 19973093
2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2-fluoroacetamide (PubChem CID 19973093) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2-fluoroacetamide.
| Compound Name | 2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 19973093 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)oxiran-2-yl]-2-fluoroacetamide |
| SMILES | NC(=O)C(F)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C10H8F3NO2/c11-5-1-2-6(7(12)3-5)10(4-16-10)8(13)9(14)15/h1-3,8H,4H2,(H2,14,15) |
| InChIKey | RVKMKXHIOYNNCK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|