C10H9FN2O3 — CID 2849441
3-(4-fluorophenyl)oxirane-2,2-dicarboxamide (PubChem CID 2849441) has the molecular formula C10H9FN2O3 and a molecular weight of 224.19 g/mol. Its IUPAC name is 3-(4-fluorophenyl)oxirane-2,2-dicarboxamide.
| Compound Name | 3-(4-fluorophenyl)oxirane-2,2-dicarboxamide |
|---|---|
| PubChem CID | 2849441 |
| Molecular Formula | C10H9FN2O3 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-(4-fluorophenyl)oxirane-2,2-dicarboxamide |
| SMILES | NC(=O)C1(C(N)=O)OC1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FN2O3/c11-6-3-1-5(2-4-6)7-10(16-7,8(12)14)9(13)15/h1-4,7H,(H2,12,14)(H2,13,15) |
| InChIKey | MRXSQRZCQIWMTN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|