C12H10O5 — CID 18961636
3-(7-hydroxy-2-oxochromen-3-yl)propanoic acid (PubChem CID 18961636) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-(7-hydroxy-2-oxochromen-3-yl)propanoic acid.
| Compound Name | 3-(7-hydroxy-2-oxochromen-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18961636 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-(7-hydroxy-2-oxochromen-3-yl)propanoic acid |
| SMILES | O=C(O)CCc1cc2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C12H10O5/c13-9-3-1-7-5-8(2-4-11(14)15)12(16)17-10(7)6-9/h1,3,5-6,13H,2,4H2,(H,14,15) |
| InChIKey | FBXYNMKDABFEMQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|