C27H34O5 — CID 90738119
18-(7-hydroxy-2-oxochromen-3-yl)octadeca-6,9,12-trienoic acid (PubChem CID 90738119) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is 18-(7-hydroxy-2-oxochromen-3-yl)octadeca-6,9,12-trienoic acid.
| Compound Name | 18-(7-hydroxy-2-oxochromen-3-yl)octadeca-6,9,12-trienoic acid |
|---|---|
| PubChem CID | 90738119 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 18-(7-hydroxy-2-oxochromen-3-yl)octadeca-6,9,12-trienoic acid |
| SMILES | O=C(O)CCCCC=CCC=CCC=CCCCCCc1cc2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C27H34O5/c28-24-19-18-22-20-23(27(31)32-25(22)21-24)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-26(29)30/h1,3-4,6-7,9,18-21,28H,2,5,8,10-17H2,(H,29,30) |
| InChIKey | ZDPDBYPMXMMGLD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|