11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid

C23H27NO5 — CID 141033903

IUPAC11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid
SMILESO=C(O)CCCCCCCCCCc1cc(=O)cc2oc3cc(O)ccc3nc1-2
InChIInChI=1S/C23H27NO5/c25-17-11-12-19-20(14-17)29-21-15-18(26)13-16(23(21)24-19)9-7-5-3-1-2-4-6-8-10-22(27)28/h11-15,25H,1-10H2,(H,27,28)
InChIKeyFKIWLMRANWWVJM-UHFFFAOYSA-N
MW397.47 g/mol
LogP5.14
Rot. Bonds11

About 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid

11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid (PubChem CID 141033903) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid.

Molecular Properties

Compound Name11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid
PubChem CID141033903
Molecular FormulaC23H27NO5
Molecular Weight397.47 g/mol
Exact Mass397.19
IUPAC Name11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid
SMILESO=C(O)CCCCCCCCCCc1cc(=O)cc2oc3cc(O)ccc3nc1-2
InChIInChI=1S/C23H27NO5/c25-17-11-12-19-20(14-17)29-21-15-18(26)13-16(23(21)24-19)9-7-5-3-1-2-4-6-8-10-22(27)28/h11-15,25H,1-10H2,(H,27,28)
InChIKeyFKIWLMRANWWVJM-UHFFFAOYSA-N
XLogP5.14
TPSA100.63 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds11
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500397.47
LogP ≤ 55.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid?
The IUPAC name of 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid (CID 141033903) is 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid.
What is the SMILES notation for 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid?
The canonical SMILES for 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid is O=C(O)CCCCCCCCCCc1cc(=O)cc2oc3cc(O)ccc3nc1-2.
What is the InChIKey of 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid?
The InChIKey is FKIWLMRANWWVJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO5/c25-17-11-12-19-20(14-17)29-21-15-18(26)13-16(23(21)24-19)9-7-5-3-1-2-4-6-8-10-22(27)28/h11-15,25H,1-10H2,(H,27,28).
What are the key properties of 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid?
11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid has a molecular weight of 397.47 g/mol, XLogP of 5.14, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(7-hydroxy-3-oxophenoxazin-1-yl)undecanoic acid is sourced from PubChem (CID 141033903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).