C15H7F4N3O4 — CID 18961694
3-(6-fluoro-2-oxo-3-prop-2-ynyl-1,3-benzoxazol-5-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 18961694) has the molecular formula C15H7F4N3O4 and a molecular weight of 369.23 g/mol. Its IUPAC name is 3-(6-fluoro-2-oxo-3-prop-2-ynyl-1,3-benzoxazol-5-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(6-fluoro-2-oxo-3-prop-2-ynyl-1,3-benzoxazol-5-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18961694 |
| Molecular Formula | C15H7F4N3O4 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 3-(6-fluoro-2-oxo-3-prop-2-ynyl-1,3-benzoxazol-5-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | C#CCn1c(=O)oc2cc(F)c(-n3c(=O)cc(C(F)(F)F)[nH]c3=O)cc21 |
| InChI | InChI=1S/C15H7F4N3O4/c1-2-3-21-9-5-8(7(16)4-10(9)26-14(21)25)22-12(23)6-11(15(17,18)19)20-13(22)24/h1,4-6H,3H2,(H,20,24) |
| InChIKey | GGKCPOSSYNVVMT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|