C19H22N2O4 — CID 18963807
2-methoxyethyl 4-methyl-5-propan-2-yloxy-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 18963807) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-methoxyethyl 4-methyl-5-propan-2-yloxy-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 2-methoxyethyl 4-methyl-5-propan-2-yloxy-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 18963807 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-methoxyethyl 4-methyl-5-propan-2-yloxy-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COCCOC(=O)c1ncc2[nH]c3cccc(OC(C)C)c3c2c1C |
| InChI | InChI=1S/C19H22N2O4/c1-11(2)25-15-7-5-6-13-17(15)16-12(3)18(20-10-14(16)21-13)19(22)24-9-8-23-4/h5-7,10-11,21H,8-9H2,1-4H3 |
| InChIKey | CQTBDUULYFXKHB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|