C14H16N2O4S — CID 18967189
4-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylpentanedioic acid (PubChem CID 18967189) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylpentanedioic acid.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylpentanedioic acid |
|---|---|
| PubChem CID | 18967189 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylpentanedioic acid |
| SMILES | CC(C)(CC(Sc1nc2ccccc2[nH]1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H16N2O4S/c1-14(2,12(19)20)7-10(11(17)18)21-13-15-8-5-3-4-6-9(8)16-13/h3-6,10H,7H2,1-2H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | ZENCFONXJJLFFS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |