C13H14N2O7S — CID 70459322
[1-(1H-benzimidazol-2-ylsulfanyl)-1-carboxyoxy-3-methoxypropan-2-yl] hydrogen carbonate (PubChem CID 70459322) has the molecular formula C13H14N2O7S and a molecular weight of 342.33 g/mol. Its IUPAC name is [1-(1H-benzimidazol-2-ylsulfanyl)-1-carboxyoxy-3-methoxypropan-2-yl] hydrogen carbonate.
| Compound Name | [1-(1H-benzimidazol-2-ylsulfanyl)-1-carboxyoxy-3-methoxypropan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70459322 |
| Molecular Formula | C13H14N2O7S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | [1-(1H-benzimidazol-2-ylsulfanyl)-1-carboxyoxy-3-methoxypropan-2-yl] hydrogen carbonate |
| SMILES | COCC(OC(=O)O)C(OC(=O)O)Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H14N2O7S/c1-20-6-9(21-12(16)17)10(22-13(18)19)23-11-14-7-4-2-3-5-8(7)15-11/h2-5,9-10H,6H2,1H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | KDRUROUBEJRIST-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|