C16H17ClFN7O2S — CID 18967459
N-[3-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propyl]methanesulfonamide (PubChem CID 18967459) has the molecular formula C16H17ClFN7O2S and a molecular weight of 425.88 g/mol. Its IUPAC name is N-[3-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 18967459 |
| Molecular Formula | C16H17ClFN7O2S |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-[3-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1ncc2ncnc(Nc3ccc(F)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C16H17ClFN7O2S/c1-28(26,27)23-6-2-5-19-16-20-8-13-14(25-16)15(22-9-21-13)24-10-3-4-12(18)11(17)7-10/h3-4,7-9,23H,2,5-6H2,1H3,(H,19,20,25)(H,21,22,24) |
| InChIKey | WZMUUNLRVSHSBB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 121.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|