About 3-butyl-3-ethyl-2H-1,4-benzothiazepine
3-butyl-3-ethyl-2H-1,4-benzothiazepine (PubChem CID 18968787) has the molecular formula C15H21NS
and a molecular weight of 247.41 g/mol. Its IUPAC name is 3-butyl-3-ethyl-2H-1,4-benzothiazepine.
Molecular Properties
| Compound Name | 3-butyl-3-ethyl-2H-1,4-benzothiazepine |
| PubChem CID | 18968787 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-butyl-3-ethyl-2H-1,4-benzothiazepine |
| SMILES | CCCCC1(CC)CSc2ccccc2C=N1 |
| InChI | InChI=1S/C15H21NS/c1-3-5-10-15(4-2)12-17-14-9-7-6-8-13(14)11-16-15/h6-9,11H,3-5,10,12H2,1-2H3 |
| InChIKey | NUGGGKYEOAMJFY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-3-ethyl-2H-1,4-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3-ethyl-2H-1,4-benzothiazepine?
The IUPAC name of 3-butyl-3-ethyl-2H-1,4-benzothiazepine (CID 18968787) is 3-butyl-3-ethyl-2H-1,4-benzothiazepine.
What is the SMILES notation for 3-butyl-3-ethyl-2H-1,4-benzothiazepine?
The canonical SMILES for 3-butyl-3-ethyl-2H-1,4-benzothiazepine is CCCCC1(CC)CSc2ccccc2C=N1.
What is the InChIKey of 3-butyl-3-ethyl-2H-1,4-benzothiazepine?
The InChIKey is NUGGGKYEOAMJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NS/c1-3-5-10-15(4-2)12-17-14-9-7-6-8-13(14)11-16-15/h6-9,11H,3-5,10,12H2,1-2H3.
What are the key properties of 3-butyl-3-ethyl-2H-1,4-benzothiazepine?
3-butyl-3-ethyl-2H-1,4-benzothiazepine has a molecular weight of 247.41 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3-ethyl-2H-1,4-benzothiazepine is sourced from PubChem (CID 18968787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).