C15H21NS — CID 18968787
3-butyl-3-ethyl-2H-1,4-benzothiazepine (PubChem CID 18968787) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 3-butyl-3-ethyl-2H-1,4-benzothiazepine.
| Compound Name | 3-butyl-3-ethyl-2H-1,4-benzothiazepine |
|---|---|
| PubChem CID | 18968787 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-butyl-3-ethyl-2H-1,4-benzothiazepine |
| SMILES | CCCCC1(CC)CSc2ccccc2C=N1 |
| InChI | InChI=1S/C15H21NS/c1-3-5-10-15(4-2)12-17-14-9-7-6-8-13(14)11-16-15/h6-9,11H,3-5,10,12H2,1-2H3 |
| InChIKey | NUGGGKYEOAMJFY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |