C19H30N4O3 — CID 18969489
methyl 4-[[1-(2-piperidin-4-ylethyl)imidazole-4-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 18969489) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 4-[[1-(2-piperidin-4-ylethyl)imidazole-4-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[1-(2-piperidin-4-ylethyl)imidazole-4-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18969489 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | methyl 4-[[1-(2-piperidin-4-ylethyl)imidazole-4-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)c2cn(CCC3CCNCC3)cn2)CC1 |
| InChI | InChI=1S/C19H30N4O3/c1-26-19(25)15-2-4-16(5-3-15)22-18(24)17-12-23(13-21-17)11-8-14-6-9-20-10-7-14/h12-16,20H,2-11H2,1H3,(H,22,24) |
| InChIKey | RLWKYNSLPVTBAF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |