C27H28N2O2 — CID 18971868
(2-ethoxyphenyl)-[4-[(2-methylpropylamino)methyl]cyclohepta[b]indol-7-yl]methanone (PubChem CID 18971868) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (2-ethoxyphenyl)-[4-[(2-methylpropylamino)methyl]cyclohepta[b]indol-7-yl]methanone.
| Compound Name | (2-ethoxyphenyl)-[4-[(2-methylpropylamino)methyl]cyclohepta[b]indol-7-yl]methanone |
|---|---|
| PubChem CID | 18971868 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (2-ethoxyphenyl)-[4-[(2-methylpropylamino)methyl]cyclohepta[b]indol-7-yl]methanone |
| SMILES | CCOc1ccccc1C(=O)c1cccc2c3cccc(CNCC(C)C)c3nc-2c1 |
| InChI | InChI=1S/C27H28N2O2/c1-4-31-25-14-6-5-11-23(25)27(30)19-9-7-12-21-22-13-8-10-20(17-28-16-18(2)3)26(22)29-24(21)15-19/h5-15,18,28H,4,16-17H2,1-3H3 |
| InChIKey | AEVPOXOGXQEAKO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |