C13H13F2NO — CID 18972381
1-(2,4-difluorophenyl)-3-methoxy-2,5-dimethylpyrrole (PubChem CID 18972381) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-methoxy-2,5-dimethylpyrrole.
| Compound Name | 1-(2,4-difluorophenyl)-3-methoxy-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 18972381 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-methoxy-2,5-dimethylpyrrole |
| SMILES | COc1cc(C)n(-c2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C13H13F2NO/c1-8-6-13(17-3)9(2)16(8)12-5-4-10(14)7-11(12)15/h4-7H,1-3H3 |
| InChIKey | SVUAEHBHHMIWJZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|