butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride

C12H14Br2ClFO — CID 18974486

IUPACbutane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride
SMILESCCCC.Cc1c(F)c(Br)cc(Br)c1C(=O)Cl
InChIInChI=1S/C8H4Br2ClFO.C4H10/c1-3-6(8(11)13)4(9)2-5(10)7(3)12;1-3-4-2/h2H,1H3;3-4H2,1-2H3
InChIKeyGCQNKMRCLKMFRY-UHFFFAOYSA-N
MW388.50 g/mol
LogP5.84
Rot. Bonds2

About butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride

butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride (PubChem CID 18974486) has the molecular formula C12H14Br2ClFO and a molecular weight of 388.50 g/mol. Its IUPAC name is butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride.

Molecular Properties

Compound Namebutane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride
PubChem CID18974486
Molecular FormulaC12H14Br2ClFO
Molecular Weight388.50 g/mol
Exact Mass385.91
IUPAC Namebutane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride
SMILESCCCC.Cc1c(F)c(Br)cc(Br)c1C(=O)Cl
InChIInChI=1S/C8H4Br2ClFO.C4H10/c1-3-6(8(11)13)4(9)2-5(10)7(3)12;1-3-4-2/h2H,1H3;3-4H2,1-2H3
InChIKeyGCQNKMRCLKMFRY-UHFFFAOYSA-N
XLogP5.84
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500388.50
LogP ≤ 55.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride?
The IUPAC name of butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride (CID 18974486) is butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride.
What is the SMILES notation for butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride?
The canonical SMILES for butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride is CCCC.Cc1c(F)c(Br)cc(Br)c1C(=O)Cl.
What is the InChIKey of butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride?
The InChIKey is GCQNKMRCLKMFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2ClFO.C4H10/c1-3-6(8(11)13)4(9)2-5(10)7(3)12;1-3-4-2/h2H,1H3;3-4H2,1-2H3.
What are the key properties of butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride?
butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride has a molecular weight of 388.50 g/mol, XLogP of 5.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride is sourced from PubChem (CID 18974486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).