C12H14Br2ClFO — CID 18974486
butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride (PubChem CID 18974486) has the molecular formula C12H14Br2ClFO and a molecular weight of 388.50 g/mol. Its IUPAC name is butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride.
| Compound Name | butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride |
|---|---|
| PubChem CID | 18974486 |
| Molecular Formula | C12H14Br2ClFO |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 385.91 |
| IUPAC Name | butane;4,6-dibromo-3-fluoro-2-methylbenzoyl chloride |
| SMILES | CCCC.Cc1c(F)c(Br)cc(Br)c1C(=O)Cl |
| InChI | InChI=1S/C8H4Br2ClFO.C4H10/c1-3-6(8(11)13)4(9)2-5(10)7(3)12;1-3-4-2/h2H,1H3;3-4H2,1-2H3 |
| InChIKey | GCQNKMRCLKMFRY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|