C20H21ClN4O2 — CID 18977165
N-[4-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]butyl]pyridine-3-carboxamide;hydrochloride (PubChem CID 18977165) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is N-[4-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]butyl]pyridine-3-carboxamide;hydrochloride.
| Compound Name | N-[4-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]butyl]pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18977165 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[4-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]butyl]pyridine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCc1ccc(-c2ccc(=O)[nH]n2)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H20N4O2.ClH/c25-19-11-10-18(23-24-19)16-8-6-15(7-9-16)4-1-2-13-22-20(26)17-5-3-12-21-14-17;/h3,5-12,14H,1-2,4,13H2,(H,22,26)(H,24,25);1H |
| InChIKey | YTVJWXUDWOGKMO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|