C14H28NO4PS2 — CID 18978278
tert-butyl N-[2-cyclohexyl-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethyl]-N-methylcarbamate (PubChem CID 18978278) has the molecular formula C14H28NO4PS2 and a molecular weight of 369.49 g/mol. Its IUPAC name is tert-butyl N-[2-cyclohexyl-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-cyclohexyl-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 18978278 |
| Molecular Formula | C14H28NO4PS2 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | tert-butyl N-[2-cyclohexyl-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethyl]-N-methylcarbamate |
| SMILES | CN(CC(OP(O)(=S)S)C1CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28NO4PS2/c1-14(2,3)18-13(16)15(4)10-12(19-20(17,21)22)11-8-6-5-7-9-11/h11-12H,5-10H2,1-4H3,(H2,17,21,22) |
| InChIKey | CSGFIEFKZLDNFT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|