C44H38N2O12 — CID 18979444
[4-methoxycarbonyl-2-[6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carbonyl]oxyphenyl] 6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carboxylate (PubChem CID 18979444) has the molecular formula C44H38N2O12 and a molecular weight of 786.79 g/mol. Its IUPAC name is [4-methoxycarbonyl-2-[6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carbonyl]oxyphenyl] 6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carboxylate.
| Compound Name | [4-methoxycarbonyl-2-[6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carbonyl]oxyphenyl] 6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18979444 |
| Molecular Formula | C44H38N2O12 |
| Molecular Weight | 786.79 g/mol |
| Exact Mass | 786.24 |
| IUPAC Name | [4-methoxycarbonyl-2-[6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carbonyl]oxyphenyl] 6-[4-(3-prop-2-enoyloxypropoxy)phenyl]pyridine-3-carboxylate |
| SMILES | C=CC(=O)OCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC)cc3OC(=O)c3ccc(-c4ccc(OCCCOC(=O)C=C)cc4)nc3)cn2)cc1 |
| InChI | InChI=1S/C44H38N2O12/c1-4-40(47)55-24-6-22-53-34-15-8-29(9-16-34)36-19-12-32(27-45-36)43(50)57-38-21-14-31(42(49)52-3)26-39(38)58-44(51)33-13-20-37(46-28-33)30-10-17-35(18-11-30)54-23-7-25-56-41(48)5-2/h4-5,8-21,26-28H,1-2,6-7,22-25H2,3H3 |
| InChIKey | NGOFYUXCJCFBIH-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 175.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.79 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|