About carbazol-3-one
carbazol-3-one (PubChem CID 18980403) has the molecular formula C12H7NO
and a molecular weight of 181.19 g/mol. Its IUPAC name is carbazol-3-one.
Molecular Properties
| Compound Name | carbazol-3-one |
| PubChem CID | 18980403 |
| Molecular Formula | C12H7NO |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | carbazol-3-one |
| SMILES | O=C1C=CC2=Nc3ccccc3C2=C1 |
| InChI | InChI=1S/C12H7NO/c14-8-5-6-12-10(7-8)9-3-1-2-4-11(9)13-12/h1-7H |
| InChIKey | VHLKRJCSUDZZTF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze carbazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbazol-3-one?
The IUPAC name of carbazol-3-one (CID 18980403) is carbazol-3-one.
What is the SMILES notation for carbazol-3-one?
The canonical SMILES for carbazol-3-one is O=C1C=CC2=Nc3ccccc3C2=C1.
What is the InChIKey of carbazol-3-one?
The InChIKey is VHLKRJCSUDZZTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO/c14-8-5-6-12-10(7-8)9-3-1-2-4-11(9)13-12/h1-7H.
What are the key properties of carbazol-3-one?
carbazol-3-one has a molecular weight of 181.19 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbazol-3-one is sourced from PubChem (CID 18980403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).