C21H19BrClF3N4O2 — CID 18980990
4-(4-bromobutanoylamino)-5-(4-chlorophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboxamide (PubChem CID 18980990) has the molecular formula C21H19BrClF3N4O2 and a molecular weight of 531.76 g/mol. Its IUPAC name is 4-(4-bromobutanoylamino)-5-(4-chlorophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 4-(4-bromobutanoylamino)-5-(4-chlorophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 18980990 |
| Molecular Formula | C21H19BrClF3N4O2 |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 4-(4-bromobutanoylamino)-5-(4-chlorophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(CCCBr)NC1CN(C(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19BrClF3N4O2/c22-11-1-2-18(31)28-17-12-30(29-19(17)13-3-7-15(23)8-4-13)20(32)27-16-9-5-14(6-10-16)21(24,25)26/h3-10,17H,1-2,11-12H2,(H,27,32)(H,28,31) |
| InChIKey | RCCGGMHXUMVCAR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|