C16H28N2O4 — CID 18984254
2-methyl-N-[3-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide (PubChem CID 18984254) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-methyl-N-[3-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 18984254 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-methyl-N-[3-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCOCCOCCCNC(=O)C(=C)C |
| InChI | InChI=1S/C16H28N2O4/c1-13(2)15(19)17-7-5-9-21-11-12-22-10-6-8-18-16(20)14(3)4/h1,3,5-12H2,2,4H3,(H,17,19)(H,18,20) |
| InChIKey | TVLZJKMRIOGQFR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|