C15H25NO5 — CID 20700086
N-[2,3-bis(2-ethenoxyethoxy)propyl]-2-methylprop-2-enamide (PubChem CID 20700086) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[2,3-bis(2-ethenoxyethoxy)propyl]-2-methylprop-2-enamide.
| Compound Name | N-[2,3-bis(2-ethenoxyethoxy)propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 20700086 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[2,3-bis(2-ethenoxyethoxy)propyl]-2-methylprop-2-enamide |
| SMILES | C=COCCOCC(CNC(=O)C(=C)C)OCCOC=C |
| InChI | InChI=1S/C15H25NO5/c1-5-18-7-8-20-12-14(21-10-9-19-6-2)11-16-15(17)13(3)4/h5-6,14H,1-3,7-12H2,4H3,(H,16,17) |
| InChIKey | QZSSOGXHTNQQMP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|