C14H15ClN2O4 — CID 18986305
(E)-but-2-enedioic acid;2-(5-chloroindol-1-yl)ethanamine (PubChem CID 18986305) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(5-chloroindol-1-yl)ethanamine.
| Compound Name | (E)-but-2-enedioic acid;2-(5-chloroindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 18986305 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(5-chloroindol-1-yl)ethanamine |
| SMILES | NCCn1ccc2cc(Cl)ccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H11ClN2.C4H4O4/c11-9-1-2-10-8(7-9)3-5-13(10)6-4-12;5-3(6)1-2-4(7)8/h1-3,5,7H,4,6,12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FVEKPKPPRDAYBT-WLHGVMLRSA-N |
| XLogP | 1.97 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|