C20H26N4O — CID 18987407
5-(1-butylpiperidin-3-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole (PubChem CID 18987407) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 5-(1-butylpiperidin-3-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-butylpiperidin-3-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 18987407 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 5-(1-butylpiperidin-3-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole |
| SMILES | CCCCN1CCCC(c2nc(-c3cn(C)c4ccccc34)no2)C1 |
| InChI | InChI=1S/C20H26N4O/c1-3-4-11-24-12-7-8-15(13-24)20-21-19(22-25-20)17-14-23(2)18-10-6-5-9-16(17)18/h5-6,9-10,14-15H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | AQUDFGFBDBREER-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |