C20H24N4O — CID 70131273
5-(1,2,3,5,6,7,8,8a-octahydroindolizin-2-ylmethyl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole (PubChem CID 70131273) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-2-ylmethyl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-2-ylmethyl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 70131273 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-2-ylmethyl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole |
| SMILES | Cn1cc(-c2noc(CC3CC4CCCCN4C3)n2)c2ccccc21 |
| InChI | InChI=1S/C20H24N4O/c1-23-13-17(16-7-2-3-8-18(16)23)20-21-19(25-22-20)11-14-10-15-6-4-5-9-24(15)12-14/h2-3,7-8,13-15H,4-6,9-12H2,1H3 |
| InChIKey | DBSUWUOENFKCKZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |