C25H21N3O8 — CID 18988726
3-[3,5-bis(4-nitrophenoxy)benzoyl]azepan-2-one (PubChem CID 18988726) has the molecular formula C25H21N3O8 and a molecular weight of 491.46 g/mol. Its IUPAC name is 3-[3,5-bis(4-nitrophenoxy)benzoyl]azepan-2-one.
| Compound Name | 3-[3,5-bis(4-nitrophenoxy)benzoyl]azepan-2-one |
|---|---|
| PubChem CID | 18988726 |
| Molecular Formula | C25H21N3O8 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3-[3,5-bis(4-nitrophenoxy)benzoyl]azepan-2-one |
| SMILES | O=C1NCCCCC1C(=O)c1cc(Oc2ccc([N+](=O)[O-])cc2)cc(Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H21N3O8/c29-24(23-3-1-2-12-26-25(23)30)16-13-21(35-19-8-4-17(5-9-19)27(31)32)15-22(14-16)36-20-10-6-18(7-11-20)28(33)34/h4-11,13-15,23H,1-3,12H2,(H,26,30) |
| InChIKey | KBJGCLIYDRCEIY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|