C19H12F4N2O3 — CID 18989452
2-[4-oxo-3-[(E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]phthalazin-1-yl]acetic acid (PubChem CID 18989452) has the molecular formula C19H12F4N2O3 and a molecular weight of 392.31 g/mol. Its IUPAC name is 2-[4-oxo-3-[(E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]phthalazin-1-yl]acetic acid.
| Compound Name | 2-[4-oxo-3-[(E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]phthalazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18989452 |
| Molecular Formula | C19H12F4N2O3 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[4-oxo-3-[(E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]phthalazin-1-yl]acetic acid |
| SMILES | O=C(O)Cc1nn(C/C=C/c2c(F)c(F)cc(F)c2F)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H12F4N2O3/c20-13-8-14(21)18(23)12(17(13)22)6-3-7-25-19(28)11-5-2-1-4-10(11)15(24-25)9-16(26)27/h1-6,8H,7,9H2,(H,26,27)/b6-3+ |
| InChIKey | ZJINMULXZIFXIV-ZZXKWVIFSA-N |
| XLogP | 3.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|