C8H7F3O — CID 18990478
2-(1,2,2-trifluoroethenoxy)cyclohexa-1,3-diene (PubChem CID 18990478) has the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethenoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(1,2,2-trifluoroethenoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 18990478 |
| Molecular Formula | C8H7F3O |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 2-(1,2,2-trifluoroethenoxy)cyclohexa-1,3-diene |
| SMILES | FC(F)=C(F)OC1=CCCC=C1 |
| InChI | InChI=1S/C8H7F3O/c9-7(10)8(11)12-6-4-2-1-3-5-6/h2,4-5H,1,3H2 |
| InChIKey | FBPGZMLEJBAVAD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|