C12H12ClN3 — CID 18992372
3-chloro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-imine (PubChem CID 18992372) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 3-chloro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-imine.
| Compound Name | 3-chloro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-imine |
|---|---|
| PubChem CID | 18992372 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-chloro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-imine |
| SMILES | [H]/N=c1/c2ccc(Cl)cc2nc2n1CCCC2 |
| InChI | InChI=1S/C12H12ClN3/c13-8-4-5-9-10(7-8)15-11-3-1-2-6-16(11)12(9)14/h4-5,7,14H,1-3,6H2/b14-12- |
| InChIKey | JZWIXWFTCJVHQM-OWBHPGMISA-N |
| XLogP | 2.51 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |