C24H21N5O6S — CID 18993199
methyl 1-(dimethylcarbamoyl)-3-[5-[[(3-nitro-4-pyridinyl)amino]methyl]thiophene-2-carbonyl]indole-4-carboxylate (PubChem CID 18993199) has the molecular formula C24H21N5O6S and a molecular weight of 507.53 g/mol. Its IUPAC name is methyl 1-(dimethylcarbamoyl)-3-[5-[[(3-nitro-4-pyridinyl)amino]methyl]thiophene-2-carbonyl]indole-4-carboxylate.
| Compound Name | methyl 1-(dimethylcarbamoyl)-3-[5-[[(3-nitro-4-pyridinyl)amino]methyl]thiophene-2-carbonyl]indole-4-carboxylate |
|---|---|
| PubChem CID | 18993199 |
| Molecular Formula | C24H21N5O6S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | methyl 1-(dimethylcarbamoyl)-3-[5-[[(3-nitro-4-pyridinyl)amino]methyl]thiophene-2-carbonyl]indole-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1c(C(=O)c1ccc(CNc3ccncc3[N+](=O)[O-])s1)cn2C(=O)N(C)C |
| InChI | InChI=1S/C24H21N5O6S/c1-27(2)24(32)28-13-16(21-15(23(31)35-3)5-4-6-18(21)28)22(30)20-8-7-14(36-20)11-26-17-9-10-25-12-19(17)29(33)34/h4-10,12-13H,11H2,1-3H3,(H,25,26) |
| InChIKey | BTUHPNDPZVDQCW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|