About 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole
4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole (PubChem CID 18993213) has the molecular formula C18H14FNO3
and a molecular weight of 311.30 g/mol. Its IUPAC name is methyl 3-(3-fluoro-4-methylbenzoyl)-1H-indole-4-carboxylate.
Molecular Properties
| Compound Name | 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole |
| PubChem CID | 18993213 |
| Molecular Formula | C18H14FNO3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | methyl 3-(3-fluoro-4-methylbenzoyl)-1H-indole-4-carboxylate |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2=CNC3=CC=CC(=C32)C(=O)OC)F |
| InChI | InChI=1S/C18H14FNO3/c1-10-6-7-11(8-14(10)19)17(21)13-9-20-15-5-3-4-12(16(13)15)18(22)23-2/h3-9,20H,1-2H3 |
| InChIKey | BOJIEHJJFRGTQH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 469 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole?
The IUPAC name of 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole (CID 18993213) is methyl 3-(3-fluoro-4-methylbenzoyl)-1H-indole-4-carboxylate.
What is the SMILES notation for 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole?
The canonical SMILES for 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole is CC1=C(C=C(C=C1)C(=O)C2=CNC3=CC=CC(=C32)C(=O)OC)F.
What is the InChIKey of 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole?
The InChIKey is BOJIEHJJFRGTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FNO3/c1-10-6-7-11(8-14(10)19)17(21)13-9-20-15-5-3-4-12(16(13)15)18(22)23-2/h3-9,20H,1-2H3.
What are the key properties of 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole?
4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole has a molecular weight of 311.30 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Methoxycarbonyl-3-(3-fluoro-4-methylbenzoyl}indole is sourced from PubChem (CID 18993213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).