C20H20N2O2 — CID 18997331
1-[(2,5-dimethylphenyl)methyl]-3-[(E)-2-nitroprop-1-enyl]indole (PubChem CID 18997331) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-3-[(E)-2-nitroprop-1-enyl]indole.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-3-[(E)-2-nitroprop-1-enyl]indole |
|---|---|
| PubChem CID | 18997331 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-3-[(E)-2-nitroprop-1-enyl]indole |
| SMILES | C/C(=C\c1cn(Cc2cc(C)ccc2C)c2ccccc12)[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N2O2/c1-14-8-9-15(2)17(10-14)12-21-13-18(11-16(3)22(23)24)19-6-4-5-7-20(19)21/h4-11,13H,12H2,1-3H3/b16-11+ |
| InChIKey | SONALHUXBDQXGO-LFIBNONCSA-N |
| XLogP | 4.94 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|