C18H26N6O — CID 18998529
4-[1-[carbamimidoyl(methyl)amino]ethyl]-N-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexane-1-carboxamide (PubChem CID 18998529) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-[1-[carbamimidoyl(methyl)amino]ethyl]-N-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-[1-[carbamimidoyl(methyl)amino]ethyl]-N-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18998529 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-[1-[carbamimidoyl(methyl)amino]ethyl]-N-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexane-1-carboxamide |
| SMILES | [H]/N=C(\N)N(C)C(C)C1CCC(C(=O)Nc2ccnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C18H26N6O/c1-11(24(2)18(19)20)12-3-5-13(6-4-12)17(25)23-15-8-10-22-16-14(15)7-9-21-16/h7-13H,3-6H2,1-2H3,(H3,19,20)(H2,21,22,23,25) |
| InChIKey | ISBMDXNORCLDNE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|