C28H24BrN7 — CID 18998676
3-[[(2E)-12-bromo-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine (PubChem CID 18998676) has the molecular formula C28H24BrN7 and a molecular weight of 538.45 g/mol. Its IUPAC name is 3-[[(2E)-12-bromo-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 3-[[(2E)-12-bromo-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 18998676 |
| Molecular Formula | C28H24BrN7 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 3-[[(2E)-12-bromo-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc2c(c1)C=Cc1c(Br)cccc1/C2=C/c1nn[nH]n1 |
| InChI | InChI=1S/C28H24BrN7/c1-4-26-31-27-16(2)12-17(3)30-28(27)36(26)15-18-8-10-20-19(13-18)9-11-22-21(6-5-7-24(22)29)23(20)14-25-32-34-35-33-25/h5-14H,4,15H2,1-3H3,(H,32,33,34,35)/b23-14+ |
| InChIKey | XNSGFUXVTQAOSX-OEAKJJBVSA-N |
| XLogP | 6.01 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|