C28H29N7 — CID 163899306
3-[[(2E)-2-(2,3-dihydro-1H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine (PubChem CID 163899306) has the molecular formula C28H29N7 and a molecular weight of 463.59 g/mol. Its IUPAC name is 3-[[(2E)-2-(2,3-dihydro-1H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 3-[[(2E)-2-(2,3-dihydro-1H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 163899306 |
| Molecular Formula | C28H29N7 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 3-[[(2E)-2-(2,3-dihydro-1H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc2c(c1)CCc1ccccc1/C2=C\C1=NNNN1 |
| InChI | InChI=1S/C28H29N7/c1-4-26-30-27-17(2)13-18(3)29-28(27)35(26)16-19-9-12-23-21(14-19)11-10-20-7-5-6-8-22(20)24(23)15-25-31-33-34-32-25/h5-9,12-15,33-34H,4,10-11,16H2,1-3H3,(H,31,32)/b24-15+ |
| InChIKey | QIKKTRQAZSBLMP-BUVRLJJBSA-N |
| XLogP | 4.12 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|